C18H17N3OS — CID 4995666
N-(5-ethyl-3-methyl-4-phenyl-1,3-thiazol-2-ylidene)pyridine-3-carboxamide (PubChem CID 4995666) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is N-(5-ethyl-3-methyl-4-phenyl-1,3-thiazol-2-ylidene)pyridine-3-carboxamide.
| Compound Name | N-(5-ethyl-3-methyl-4-phenyl-1,3-thiazol-2-ylidene)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4995666 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-(5-ethyl-3-methyl-4-phenyl-1,3-thiazol-2-ylidene)pyridine-3-carboxamide |
| SMILES | CCc1s/c(=N\C(=O)c2cccnc2)n(C)c1-c1ccccc1 |
| InChI | InChI=1S/C18H17N3OS/c1-3-15-16(13-8-5-4-6-9-13)21(2)18(23-15)20-17(22)14-10-7-11-19-12-14/h4-12H,3H2,1-2H3/b20-18- |
| InChIKey | QHFUENGGZFACII-ZZEZOPTASA-N |
| XLogP | 3.45 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|