C19H15ClFN3O3S — CID 126202750
2-chloro-N-[5-ethyl-4-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-ylidene]-4-nitrobenzamide (PubChem CID 126202750) has the molecular formula C19H15ClFN3O3S and a molecular weight of 419.87 g/mol. Its IUPAC name is 2-chloro-N-[5-ethyl-4-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-ylidene]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[5-ethyl-4-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-ylidene]-4-nitrobenzamide |
|---|---|
| PubChem CID | 126202750 |
| Molecular Formula | C19H15ClFN3O3S |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 2-chloro-N-[5-ethyl-4-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-ylidene]-4-nitrobenzamide |
| SMILES | CCc1s/c(=N\C(=O)c2ccc([N+](=O)[O-])cc2Cl)n(C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15ClFN3O3S/c1-3-16-17(11-4-6-12(21)7-5-11)23(2)19(28-16)22-18(25)14-9-8-13(24(26)27)10-15(14)20/h4-10H,3H2,1-2H3/b22-19- |
| InChIKey | OTGLJJZJBWYTQG-QOCHGBHMSA-N |
| XLogP | 4.76 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|