C19H16Cl2N2O2S — CID 126209248
2,4-dichloro-N-[4-(4-methoxyphenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]benzamide (PubChem CID 126209248) has the molecular formula C19H16Cl2N2O2S and a molecular weight of 407.32 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(4-methoxyphenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]benzamide.
| Compound Name | 2,4-dichloro-N-[4-(4-methoxyphenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 126209248 |
| Molecular Formula | C19H16Cl2N2O2S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 2,4-dichloro-N-[4-(4-methoxyphenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]benzamide |
| SMILES | COc1ccc(-c2c(C)s/c(=N\C(=O)c3ccc(Cl)cc3Cl)n2C)cc1 |
| InChI | InChI=1S/C19H16Cl2N2O2S/c1-11-17(12-4-7-14(25-3)8-5-12)23(2)19(26-11)22-18(24)15-9-6-13(20)10-16(15)21/h4-10H,1-3H3/b22-19- |
| InChIKey | VWRKEOMPNMAMMO-QOCHGBHMSA-N |
| XLogP | 5.12 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|