C19H17FN2O2S — CID 1021952
N-[4-(4-fluorophenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]-3-methoxybenzamide (PubChem CID 1021952) has the molecular formula C19H17FN2O2S and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]-3-methoxybenzamide.
| Compound Name | N-[4-(4-fluorophenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]-3-methoxybenzamide |
|---|---|
| PubChem CID | 1021952 |
| Molecular Formula | C19H17FN2O2S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[4-(4-fluorophenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)/N=c2\sc(C)c(-c3ccc(F)cc3)n2C)c1 |
| InChI | InChI=1S/C19H17FN2O2S/c1-12-17(13-7-9-15(20)10-8-13)22(2)19(25-12)21-18(23)14-5-4-6-16(11-14)24-3/h4-11H,1-3H3/b21-19- |
| InChIKey | NUOZELTYFPSXIO-VZCXRCSSSA-N |
| XLogP | 3.95 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|