C18H17FN2O2S — CID 41149476
N-(4-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-3-methoxybenzamide (PubChem CID 41149476) has the molecular formula C18H17FN2O2S and a molecular weight of 344.41 g/mol. Its IUPAC name is N-(4-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-3-methoxybenzamide.
| Compound Name | N-(4-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-3-methoxybenzamide |
|---|---|
| PubChem CID | 41149476 |
| Molecular Formula | C18H17FN2O2S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-(4-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-3-methoxybenzamide |
| SMILES | CCCn1/c(=N/C(=O)c2cccc(OC)c2)sc2cccc(F)c21 |
| InChI | InChI=1S/C18H17FN2O2S/c1-3-10-21-16-14(19)8-5-9-15(16)24-18(21)20-17(22)12-6-4-7-13(11-12)23-2/h4-9,11H,3,10H2,1-2H3/b20-18- |
| InChIKey | RPGXSAJGZYVRIP-ZZEZOPTASA-N |
| XLogP | 4.00 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |