C18H14BrFN2OS — CID 126212480
N-[4-(4-bromophenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]-2-fluorobenzamide (PubChem CID 126212480) has the molecular formula C18H14BrFN2OS and a molecular weight of 405.29 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]-2-fluorobenzamide.
| Compound Name | N-[4-(4-bromophenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]-2-fluorobenzamide |
|---|---|
| PubChem CID | 126212480 |
| Molecular Formula | C18H14BrFN2OS |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | N-[4-(4-bromophenyl)-3,5-dimethyl-1,3-thiazol-2-ylidene]-2-fluorobenzamide |
| SMILES | Cc1s/c(=N\C(=O)c2ccccc2F)n(C)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H14BrFN2OS/c1-11-16(12-7-9-13(19)10-8-12)22(2)18(24-11)21-17(23)14-5-3-4-6-15(14)20/h3-10H,1-2H3/b21-18- |
| InChIKey | SHKGSYQXTVUGOF-UZYVYHOESA-N |
| XLogP | 4.70 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|