C17H16N2O2S — CID 838622
N-[3,5-dimethyl-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]furan-2-carboxamide (PubChem CID 838622) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-[3,5-dimethyl-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]furan-2-carboxamide.
| Compound Name | N-[3,5-dimethyl-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]furan-2-carboxamide |
|---|---|
| PubChem CID | 838622 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[3,5-dimethyl-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]furan-2-carboxamide |
| SMILES | Cc1ccc(-c2c(C)s/c(=N\C(=O)c3ccco3)n2C)cc1 |
| InChI | InChI=1S/C17H16N2O2S/c1-11-6-8-13(9-7-11)15-12(2)22-17(19(15)3)18-16(20)14-5-4-10-21-14/h4-10H,1-3H3/b18-17- |
| InChIKey | JSOONLWDVGTLNT-ZCXUNETKSA-N |
| XLogP | 3.70 |
| TPSA | 47.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|