C24H20N2OS — CID 126212032
3-methyl-N-(3-methyl-4,5-diphenyl-1,3-thiazol-2-ylidene)benzamide (PubChem CID 126212032) has the molecular formula C24H20N2OS and a molecular weight of 384.50 g/mol. Its IUPAC name is 3-methyl-N-(3-methyl-4,5-diphenyl-1,3-thiazol-2-ylidene)benzamide.
| Compound Name | 3-methyl-N-(3-methyl-4,5-diphenyl-1,3-thiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 126212032 |
| Molecular Formula | C24H20N2OS |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-methyl-N-(3-methyl-4,5-diphenyl-1,3-thiazol-2-ylidene)benzamide |
| SMILES | Cc1cccc(C(=O)/N=c2\sc(-c3ccccc3)c(-c3ccccc3)n2C)c1 |
| InChI | InChI=1S/C24H20N2OS/c1-17-10-9-15-20(16-17)23(27)25-24-26(2)21(18-11-5-3-6-12-18)22(28-24)19-13-7-4-8-14-19/h3-16H,1-2H3/b25-24- |
| InChIKey | KGWMUDMYRFJCPY-IZHYLOQSSA-N |
| XLogP | 5.47 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |