C24H20N2O2S — CID 1008314
N-[3-(2-hydroxyethyl)-4,5-diphenyl-1,3-thiazol-2-ylidene]benzamide (PubChem CID 1008314) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[3-(2-hydroxyethyl)-4,5-diphenyl-1,3-thiazol-2-ylidene]benzamide.
| Compound Name | N-[3-(2-hydroxyethyl)-4,5-diphenyl-1,3-thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 1008314 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[3-(2-hydroxyethyl)-4,5-diphenyl-1,3-thiazol-2-ylidene]benzamide |
| SMILES | O=C(/N=c1\sc(-c2ccccc2)c(-c2ccccc2)n1CCO)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O2S/c27-17-16-26-21(18-10-4-1-5-11-18)22(19-12-6-2-7-13-19)29-24(26)25-23(28)20-14-8-3-9-15-20/h1-15,27H,16-17H2/b25-24- |
| InChIKey | KEUINQITNOYLAM-IZHYLOQSSA-N |
| XLogP | 4.62 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |