C20H20N2O2S — CID 4525917
N-[3-(3,3-dimethyl-2-oxobutyl)-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 4525917) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-[3-(3,3-dimethyl-2-oxobutyl)-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | N-[3-(3,3-dimethyl-2-oxobutyl)-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 4525917 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[3-(3,3-dimethyl-2-oxobutyl)-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CC(C)(C)C(=O)Cn1/c(=N/C(=O)c2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C20H20N2O2S/c1-20(2,3)17(23)13-22-15-11-7-8-12-16(15)25-19(22)21-18(24)14-9-5-4-6-10-14/h4-12H,13H2,1-3H3/b21-19- |
| InChIKey | OTIPFCOKVSEPLH-VZCXRCSSSA-N |
| XLogP | 4.06 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |