C28H26FN3O3S — CID 90488296
N-[3-[[4-[(4-fluorophenyl)methylcarbamoyl]phenyl]methyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]-3-methoxybenzamide (PubChem CID 90488296) has the molecular formula C28H26FN3O3S and a molecular weight of 503.60 g/mol. Its IUPAC name is N-[3-[[4-[(4-fluorophenyl)methylcarbamoyl]phenyl]methyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]-3-methoxybenzamide.
| Compound Name | N-[3-[[4-[(4-fluorophenyl)methylcarbamoyl]phenyl]methyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]-3-methoxybenzamide |
|---|---|
| PubChem CID | 90488296 |
| Molecular Formula | C28H26FN3O3S |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[3-[[4-[(4-fluorophenyl)methylcarbamoyl]phenyl]methyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)/N=c2\sc(C)c(C)n2Cc2ccc(C(=O)NCc3ccc(F)cc3)cc2)c1 |
| InChI | InChI=1S/C28H26FN3O3S/c1-18-19(2)36-28(31-27(34)23-5-4-6-25(15-23)35-3)32(18)17-21-7-11-22(12-8-21)26(33)30-16-20-9-13-24(29)14-10-20/h4-15H,16-17H2,1-3H3,(H,30,33)/b31-28- |
| InChIKey | LGSLFTHWHCHULP-PNOGMODKSA-N |
| XLogP | 5.03 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|