C29H29N3O3S — CID 97413846
N-[4,5-dimethyl-3-[[4-[[(1S)-1-phenylethyl]carbamoyl]phenyl]methyl]-1,3-thiazol-2-ylidene]-3-methoxybenzamide (PubChem CID 97413846) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is N-[4,5-dimethyl-3-[[4-[[(1S)-1-phenylethyl]carbamoyl]phenyl]methyl]-1,3-thiazol-2-ylidene]-3-methoxybenzamide.
| Compound Name | N-[4,5-dimethyl-3-[[4-[[(1S)-1-phenylethyl]carbamoyl]phenyl]methyl]-1,3-thiazol-2-ylidene]-3-methoxybenzamide |
|---|---|
| PubChem CID | 97413846 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[4,5-dimethyl-3-[[4-[[(1S)-1-phenylethyl]carbamoyl]phenyl]methyl]-1,3-thiazol-2-ylidene]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)/N=c2\sc(C)c(C)n2Cc2ccc(C(=O)N[C@@H](C)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C29H29N3O3S/c1-19(23-9-6-5-7-10-23)30-27(33)24-15-13-22(14-16-24)18-32-20(2)21(3)36-29(32)31-28(34)25-11-8-12-26(17-25)35-4/h5-17,19H,18H2,1-4H3,(H,30,33)/b31-29-/t19-/m0/s1 |
| InChIKey | BXSFDWRJFXTCKT-WFZKVATBSA-N |
| XLogP | 5.46 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|