C26H25N3O3S — CID 71958249
5-[[4-methyl-2-(3-methylbenzoyl)imino-1,3-thiazol-3-yl]methyl]-N-(1-phenylethyl)furan-2-carboxamide (PubChem CID 71958249) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is 5-[[4-methyl-2-(3-methylbenzoyl)imino-1,3-thiazol-3-yl]methyl]-N-(1-phenylethyl)furan-2-carboxamide.
| Compound Name | 5-[[4-methyl-2-(3-methylbenzoyl)imino-1,3-thiazol-3-yl]methyl]-N-(1-phenylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 71958249 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 5-[[4-methyl-2-(3-methylbenzoyl)imino-1,3-thiazol-3-yl]methyl]-N-(1-phenylethyl)furan-2-carboxamide |
| SMILES | Cc1cccc(C(=O)/N=c2\scc(C)n2Cc2ccc(C(=O)NC(C)c3ccccc3)o2)c1 |
| InChI | InChI=1S/C26H25N3O3S/c1-17-8-7-11-21(14-17)24(30)28-26-29(18(2)16-33-26)15-22-12-13-23(32-22)25(31)27-19(3)20-9-5-4-6-10-20/h4-14,16,19H,15H2,1-3H3,(H,27,31)/b28-26- |
| InChIKey | UOQRWAHHWUBEPL-SGEDCAFJSA-N |
| XLogP | 5.04 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|