C22H25ClN4O3S — CID 51067213
5-[[2-(3-chlorobenzoyl)imino-4,5-dimethyl-1,3-thiazol-3-yl]methyl]-N-[2-(dimethylamino)ethyl]furan-2-carboxamide (PubChem CID 51067213) has the molecular formula C22H25ClN4O3S and a molecular weight of 460.99 g/mol. Its IUPAC name is 5-[[2-(3-chlorobenzoyl)imino-4,5-dimethyl-1,3-thiazol-3-yl]methyl]-N-[2-(dimethylamino)ethyl]furan-2-carboxamide.
| Compound Name | 5-[[2-(3-chlorobenzoyl)imino-4,5-dimethyl-1,3-thiazol-3-yl]methyl]-N-[2-(dimethylamino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51067213 |
| Molecular Formula | C22H25ClN4O3S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 5-[[2-(3-chlorobenzoyl)imino-4,5-dimethyl-1,3-thiazol-3-yl]methyl]-N-[2-(dimethylamino)ethyl]furan-2-carboxamide |
| SMILES | Cc1s/c(=N\C(=O)c2cccc(Cl)c2)n(Cc2ccc(C(=O)NCCN(C)C)o2)c1C |
| InChI | InChI=1S/C22H25ClN4O3S/c1-14-15(2)31-22(25-20(28)16-6-5-7-17(23)12-16)27(14)13-18-8-9-19(30-18)21(29)24-10-11-26(3)4/h5-9,12H,10-11,13H2,1-4H3,(H,24,29)/b25-22- |
| InChIKey | HPXLUFWEMJQRLT-LVWGJNHUSA-N |
| XLogP | 3.49 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|