C11H13N3O3S — CID 55213097
5-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]furan-2-carbohydrazide (PubChem CID 55213097) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 5-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]furan-2-carbohydrazide.
| Compound Name | 5-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 55213097 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]furan-2-carbohydrazide |
| SMILES | Cc1sc(=O)n(Cc2ccc(C(=O)NN)o2)c1C |
| InChI | InChI=1S/C11H13N3O3S/c1-6-7(2)18-11(16)14(6)5-8-3-4-9(17-8)10(15)13-12/h3-4H,5,12H2,1-2H3,(H,13,15) |
| InChIKey | PQHBFVUBNJIQGV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|