C14H11N3O4 — CID 63572812
5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-carbohydrazide (PubChem CID 63572812) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-carbohydrazide.
| Compound Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 63572812 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-carbohydrazide |
| SMILES | NNC(=O)c1ccc(CN2C(=O)c3ccccc3C2=O)o1 |
| InChI | InChI=1S/C14H11N3O4/c15-16-12(18)11-6-5-8(21-11)7-17-13(19)9-3-1-2-4-10(9)14(17)20/h1-6H,7,15H2,(H,16,18) |
| InChIKey | RBMAHTWDLHNLSN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|