C16H14N2O5 — CID 170872488
3-amino-3-[5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-yl]propanoic acid (PubChem CID 170872488) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 3-amino-3-[5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-yl]propanoic acid.
| Compound Name | 3-amino-3-[5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 170872488 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-amino-3-[5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-yl]propanoic acid |
| SMILES | NC(CC(=O)O)c1ccc(CN2C(=O)c3ccccc3C2=O)o1 |
| InChI | InChI=1S/C16H14N2O5/c17-12(7-14(19)20)13-6-5-9(23-13)8-18-15(21)10-3-1-2-4-11(10)16(18)22/h1-6,12H,7-8,17H2,(H,19,20) |
| InChIKey | GMLHJIGEPPACON-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|