C17H14N2O4 — CID 23444673
6-amino-3-[(1,3-dioxoisoindol-2-yl)methyl]-2-methylbenzoic acid (PubChem CID 23444673) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 6-amino-3-[(1,3-dioxoisoindol-2-yl)methyl]-2-methylbenzoic acid.
| Compound Name | 6-amino-3-[(1,3-dioxoisoindol-2-yl)methyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 23444673 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 6-amino-3-[(1,3-dioxoisoindol-2-yl)methyl]-2-methylbenzoic acid |
| SMILES | Cc1c(CN2C(=O)c3ccccc3C2=O)ccc(N)c1C(=O)O |
| InChI | InChI=1S/C17H14N2O4/c1-9-10(6-7-13(18)14(9)17(22)23)8-19-15(20)11-4-2-3-5-12(11)16(19)21/h2-7H,8,18H2,1H3,(H,22,23) |
| InChIKey | PMATXISNPHOHHV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|