C23H14N2O7 — CID 127042329
2-[[2-(4-carboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid (PubChem CID 127042329) has the molecular formula C23H14N2O7 and a molecular weight of 430.37 g/mol. Its IUPAC name is 2-[[2-(4-carboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[2-(4-carboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 127042329 |
| Molecular Formula | C23H14N2O7 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2-[[2-(4-carboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)c3ccc(C(=O)Nc4ccccc4C(=O)O)cc3C2=O)cc1 |
| InChI | InChI=1S/C23H14N2O7/c26-19(24-18-4-2-1-3-16(18)23(31)32)13-7-10-15-17(11-13)21(28)25(20(15)27)14-8-5-12(6-9-14)22(29)30/h1-11H,(H,24,26)(H,29,30)(H,31,32) |
| InChIKey | HZBPRFOEZIPHPY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|