About 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid
4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid (PubChem CID 78319379) has the molecular formula C24H23NO4
and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid |
| PubChem CID | 78319379 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid |
| SMILES | Cc1ccc(-c2cccc(CO)c2)cc1C(=O)Nc1c(C)cc(C(=O)O)cc1C |
| InChI | InChI=1S/C24H23NO4/c1-14-7-8-19(18-6-4-5-17(11-18)13-26)12-21(14)23(27)25-22-15(2)9-20(24(28)29)10-16(22)3/h4-12,26H,13H2,1-3H3,(H,25,27)(H,28,29) |
| InChIKey | DTDVWKGRISYBCN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid?
The IUPAC name of 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid (CID 78319379) is 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid.
What is the SMILES notation for 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid?
The canonical SMILES for 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid is Cc1ccc(-c2cccc(CO)c2)cc1C(=O)Nc1c(C)cc(C(=O)O)cc1C.
What is the InChIKey of 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid?
The InChIKey is DTDVWKGRISYBCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO4/c1-14-7-8-19(18-6-4-5-17(11-18)13-26)12-21(14)23(27)25-22-15(2)9-20(24(28)29)10-16(22)3/h4-12,26H,13H2,1-3H3,(H,25,27)(H,28,29).
What are the key properties of 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid?
4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid has a molecular weight of 389.45 g/mol, XLogP of 4.72, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-[3-(hydroxymethyl)phenyl]-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid is sourced from PubChem (CID 78319379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).