C22H14N2O5 — CID 3950536
2-[(1,3-dioxo-2-phenylisoindole-5-carbonyl)amino]benzoic acid (PubChem CID 3950536) has the molecular formula C22H14N2O5 and a molecular weight of 386.36 g/mol. Its IUPAC name is 2-[(1,3-dioxo-2-phenylisoindole-5-carbonyl)amino]benzoic acid.
| Compound Name | 2-[(1,3-dioxo-2-phenylisoindole-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 3950536 |
| Molecular Formula | C22H14N2O5 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[(1,3-dioxo-2-phenylisoindole-5-carbonyl)amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1ccc2c(c1)C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C22H14N2O5/c25-19(23-18-9-5-4-8-16(18)22(28)29)13-10-11-15-17(12-13)21(27)24(20(15)26)14-6-2-1-3-7-14/h1-12H,(H,23,25)(H,28,29) |
| InChIKey | RGRFEPRNSJRTHK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|