C24H18N2O5 — CID 2966318
2-[[1,3-dioxo-2-(1-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid (PubChem CID 2966318) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-[[1,3-dioxo-2-(1-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[1,3-dioxo-2-(1-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2966318 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-[[1,3-dioxo-2-(1-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid |
| SMILES | CC(c1ccccc1)N1C(=O)c2ccc(C(=O)Nc3ccccc3C(=O)O)cc2C1=O |
| InChI | InChI=1S/C24H18N2O5/c1-14(15-7-3-2-4-8-15)26-22(28)17-12-11-16(13-19(17)23(26)29)21(27)25-20-10-6-5-9-18(20)24(30)31/h2-14H,1H3,(H,25,27)(H,30,31) |
| InChIKey | UUTBRGSTQJFDOS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|