C12H14N4O4 — CID 79374701
5-[(2-methoxy-4-methyl-6-oxopyrimidin-1-yl)methyl]furan-2-carbohydrazide (PubChem CID 79374701) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 5-[(2-methoxy-4-methyl-6-oxopyrimidin-1-yl)methyl]furan-2-carbohydrazide.
| Compound Name | 5-[(2-methoxy-4-methyl-6-oxopyrimidin-1-yl)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 79374701 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-[(2-methoxy-4-methyl-6-oxopyrimidin-1-yl)methyl]furan-2-carbohydrazide |
| SMILES | COc1nc(C)cc(=O)n1Cc1ccc(C(=O)NN)o1 |
| InChI | InChI=1S/C12H14N4O4/c1-7-5-10(17)16(12(14-7)19-2)6-8-3-4-9(20-8)11(18)15-13/h3-5H,6,13H2,1-2H3,(H,15,18) |
| InChIKey | AYFCIZOKUIQQGR-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|