C25H30N4O2S — CID 83283014
N-[2-(dimethylamino)ethyl]-2-[[4,5-dimethyl-2-(3-methylbenzoyl)imino-1,3-thiazol-3-yl]methyl]benzamide (PubChem CID 83283014) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[[4,5-dimethyl-2-(3-methylbenzoyl)imino-1,3-thiazol-3-yl]methyl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[[4,5-dimethyl-2-(3-methylbenzoyl)imino-1,3-thiazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 83283014 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[[4,5-dimethyl-2-(3-methylbenzoyl)imino-1,3-thiazol-3-yl]methyl]benzamide |
| SMILES | Cc1cccc(C(=O)/N=c2\sc(C)c(C)n2Cc2ccccc2C(=O)NCCN(C)C)c1 |
| InChI | InChI=1S/C25H30N4O2S/c1-17-9-8-11-20(15-17)23(30)27-25-29(18(2)19(3)32-25)16-21-10-6-7-12-22(21)24(31)26-13-14-28(4)5/h6-12,15H,13-14,16H2,1-5H3,(H,26,31)/b27-25- |
| InChIKey | UAYVSOMINZDECP-RFBIWTDZSA-N |
| XLogP | 3.56 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|