C15H16ClN3O2S — CID 131843506
3-chloro-N-[3-[2-(dimethylamino)-2-oxoethyl]-4-methyl-1,3-thiazol-2-ylidene]benzamide (PubChem CID 131843506) has the molecular formula C15H16ClN3O2S and a molecular weight of 337.83 g/mol. Its IUPAC name is 3-chloro-N-[3-[2-(dimethylamino)-2-oxoethyl]-4-methyl-1,3-thiazol-2-ylidene]benzamide.
| Compound Name | 3-chloro-N-[3-[2-(dimethylamino)-2-oxoethyl]-4-methyl-1,3-thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 131843506 |
| Molecular Formula | C15H16ClN3O2S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-chloro-N-[3-[2-(dimethylamino)-2-oxoethyl]-4-methyl-1,3-thiazol-2-ylidene]benzamide |
| SMILES | Cc1cs/c(=N\C(=O)c2cccc(Cl)c2)n1CC(=O)N(C)C |
| InChI | InChI=1S/C15H16ClN3O2S/c1-10-9-22-15(19(10)8-13(20)18(2)3)17-14(21)11-5-4-6-12(16)7-11/h4-7,9H,8H2,1-3H3/b17-15- |
| InChIKey | YPPQKGWAIHIHEA-ICFOKQHNSA-N |
| XLogP | 2.34 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|