C20H17ClFN3O2S — CID 51067230
3-chloro-N-[3-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-4-methyl-1,3-thiazol-2-ylidene]benzamide (PubChem CID 51067230) has the molecular formula C20H17ClFN3O2S and a molecular weight of 417.89 g/mol. Its IUPAC name is 3-chloro-N-[3-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-4-methyl-1,3-thiazol-2-ylidene]benzamide.
| Compound Name | 3-chloro-N-[3-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-4-methyl-1,3-thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 51067230 |
| Molecular Formula | C20H17ClFN3O2S |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 3-chloro-N-[3-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-4-methyl-1,3-thiazol-2-ylidene]benzamide |
| SMILES | Cc1cs/c(=N\C(=O)c2cccc(Cl)c2)n1CC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H17ClFN3O2S/c1-13-12-28-20(24-19(27)15-3-2-4-16(21)9-15)25(13)11-18(26)23-10-14-5-7-17(22)8-6-14/h2-9,12H,10-11H2,1H3,(H,23,26)/b24-20- |
| InChIKey | POWGWZRITBCINM-GFMRDNFCSA-N |
| XLogP | 3.71 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|