C19H21ClFN3O3S — CID 27185871
2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 27185871) has the molecular formula C19H21ClFN3O3S and a molecular weight of 425.91 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 27185871 |
| Molecular Formula | C19H21ClFN3O3S |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21ClFN3O3S/c20-16-2-1-3-18(12-16)28(26,27)24-10-8-23(9-11-24)14-19(25)22-13-15-4-6-17(21)7-5-15/h1-7,12H,8-11,13-14H2,(H,22,25) |
| InChIKey | CGCXYGQLQKGDKU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |