C19H23ClN4O3S — CID 25333150
2-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 25333150) has the molecular formula C19H23ClN4O3S and a molecular weight of 422.94 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 25333150 |
| Molecular Formula | C19H23ClN4O3S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)CN2CCN(c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C19H23ClN4O3S/c20-16-2-1-3-17(12-16)24-10-8-23(9-11-24)14-19(25)22-13-15-4-6-18(7-5-15)28(21,26)27/h1-7,12H,8-11,13-14H2,(H,22,25)(H2,21,26,27) |
| InChIKey | GNBVOXGNERFJFN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |