C20H31N5O4S — CID 30739658
2-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 30739658) has the molecular formula C20H31N5O4S and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 30739658 |
| Molecular Formula | C20H31N5O4S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 2-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)CN2CCN(CC(=O)N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H31N5O4S/c21-30(28,29)18-6-4-17(5-7-18)14-22-19(26)15-23-10-12-24(13-11-23)16-20(27)25-8-2-1-3-9-25/h4-7H,1-3,8-16H2,(H,22,26)(H2,21,28,29) |
| InChIKey | DXKVTRATQRCOCR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |