C11H14N6O3S — CID 112521930
2-(4-aminotriazol-2-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 112521930) has the molecular formula C11H14N6O3S and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-(4-aminotriazol-2-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-(4-aminotriazol-2-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 112521930 |
| Molecular Formula | C11H14N6O3S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(4-aminotriazol-2-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | Nc1cnn(CC(=O)NCc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C11H14N6O3S/c12-10-6-15-17(16-10)7-11(18)14-5-8-1-3-9(4-2-8)21(13,19)20/h1-4,6H,5,7H2,(H2,12,16)(H,14,18)(H2,13,19,20) |
| InChIKey | LUZTWRPZGSIAPQ-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |