C13H17N5O5S2 — CID 112522307
2-[4-(methanesulfonamido)triazol-2-yl]-N-[(4-methylsulfonylphenyl)methyl]acetamide (PubChem CID 112522307) has the molecular formula C13H17N5O5S2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[4-(methanesulfonamido)triazol-2-yl]-N-[(4-methylsulfonylphenyl)methyl]acetamide.
| Compound Name | 2-[4-(methanesulfonamido)triazol-2-yl]-N-[(4-methylsulfonylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 112522307 |
| Molecular Formula | C13H17N5O5S2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-[4-(methanesulfonamido)triazol-2-yl]-N-[(4-methylsulfonylphenyl)methyl]acetamide |
| SMILES | CS(=O)(=O)Nc1cnn(CC(=O)NCc2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C13H17N5O5S2/c1-24(20,21)11-5-3-10(4-6-11)7-14-13(19)9-18-15-8-12(16-18)17-25(2,22)23/h3-6,8H,7,9H2,1-2H3,(H,14,19)(H,16,17) |
| InChIKey | VFRAYAIAGPPBJU-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |