C15H19N5O4S — CID 112522313
N-[1-[2-[(4-methylsulfonylphenyl)methylamino]-2-oxoethyl]triazol-4-yl]propanamide (PubChem CID 112522313) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is N-[1-[2-[(4-methylsulfonylphenyl)methylamino]-2-oxoethyl]triazol-4-yl]propanamide.
| Compound Name | N-[1-[2-[(4-methylsulfonylphenyl)methylamino]-2-oxoethyl]triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 112522313 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[1-[2-[(4-methylsulfonylphenyl)methylamino]-2-oxoethyl]triazol-4-yl]propanamide |
| SMILES | CCC(=O)Nc1cn(CC(=O)NCc2ccc(S(C)(=O)=O)cc2)nn1 |
| InChI | InChI=1S/C15H19N5O4S/c1-3-14(21)17-13-9-20(19-18-13)10-15(22)16-8-11-4-6-12(7-5-11)25(2,23)24/h4-7,9H,3,8,10H2,1-2H3,(H,16,22)(H,17,21) |
| InChIKey | NNORGBYGCYEVNA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |