C14H17N5O5S — CID 112522309
methyl N-[1-[2-[(4-methylsulfonylphenyl)methylamino]-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112522309) has the molecular formula C14H17N5O5S and a molecular weight of 367.39 g/mol. Its IUPAC name is methyl N-[1-[2-[(4-methylsulfonylphenyl)methylamino]-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | methyl N-[1-[2-[(4-methylsulfonylphenyl)methylamino]-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112522309 |
| Molecular Formula | C14H17N5O5S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | methyl N-[1-[2-[(4-methylsulfonylphenyl)methylamino]-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cn(CC(=O)NCc2ccc(S(C)(=O)=O)cc2)nn1 |
| InChI | InChI=1S/C14H17N5O5S/c1-24-14(21)16-12-8-19(18-17-12)9-13(20)15-7-10-3-5-11(6-4-10)25(2,22)23/h3-6,8H,7,9H2,1-2H3,(H,15,20)(H,16,21) |
| InChIKey | PFJDNMPNJBSTNT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |