C14H18N6O2 — CID 112520099
N-benzyl-2-[4-(dimethylcarbamoylamino)triazol-2-yl]acetamide (PubChem CID 112520099) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is N-benzyl-2-[4-(dimethylcarbamoylamino)triazol-2-yl]acetamide.
| Compound Name | N-benzyl-2-[4-(dimethylcarbamoylamino)triazol-2-yl]acetamide |
|---|---|
| PubChem CID | 112520099 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-benzyl-2-[4-(dimethylcarbamoylamino)triazol-2-yl]acetamide |
| SMILES | CN(C)C(=O)Nc1cnn(CC(=O)NCc2ccccc2)n1 |
| InChI | InChI=1S/C14H18N6O2/c1-19(2)14(22)17-12-9-16-20(18-12)10-13(21)15-8-11-6-4-3-5-7-11/h3-7,9H,8,10H2,1-2H3,(H,15,21)(H,17,18,22) |
| InChIKey | CAHKAZKOTHODNQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |