C14H16N6O3S — CID 112527152
N-[2-[2-(3-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]methanesulfonamide (PubChem CID 112527152) has the molecular formula C14H16N6O3S and a molecular weight of 348.39 g/mol. Its IUPAC name is N-[2-[2-(3-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]methanesulfonamide.
| Compound Name | N-[2-[2-(3-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 112527152 |
| Molecular Formula | C14H16N6O3S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[2-[2-(3-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]methanesulfonamide |
| SMILES | Cc1c(N)c2ccccc2n1C(=O)Cn1ncc(NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C14H16N6O3S/c1-9-14(15)10-5-3-4-6-11(10)20(9)13(21)8-19-16-7-12(17-19)18-24(2,22)23/h3-7H,8,15H2,1-2H3,(H,17,18) |
| InChIKey | IUQHFMGQTCRCQF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |