C12H13N7O3S — CID 112527421
N-[2-[2-(5-aminobenzimidazol-1-yl)-2-oxoethyl]triazol-4-yl]methanesulfonamide (PubChem CID 112527421) has the molecular formula C12H13N7O3S and a molecular weight of 335.35 g/mol. Its IUPAC name is N-[2-[2-(5-aminobenzimidazol-1-yl)-2-oxoethyl]triazol-4-yl]methanesulfonamide.
| Compound Name | N-[2-[2-(5-aminobenzimidazol-1-yl)-2-oxoethyl]triazol-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 112527421 |
| Molecular Formula | C12H13N7O3S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-[2-[2-(5-aminobenzimidazol-1-yl)-2-oxoethyl]triazol-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cnn(CC(=O)n2cnc3cc(N)ccc32)n1 |
| InChI | InChI=1S/C12H13N7O3S/c1-23(21,22)17-11-5-15-19(16-11)6-12(20)18-7-14-9-4-8(13)2-3-10(9)18/h2-5,7H,6,13H2,1H3,(H,16,17) |
| InChIKey | DWBDJPKMQYOWJB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|