C14H15N7O2 — CID 112527657
N-[2-[2-(5-amino-2-methylbenzimidazol-1-yl)-2-oxoethyl]triazol-4-yl]acetamide (PubChem CID 112527657) has the molecular formula C14H15N7O2 and a molecular weight of 313.32 g/mol. Its IUPAC name is N-[2-[2-(5-amino-2-methylbenzimidazol-1-yl)-2-oxoethyl]triazol-4-yl]acetamide.
| Compound Name | N-[2-[2-(5-amino-2-methylbenzimidazol-1-yl)-2-oxoethyl]triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 112527657 |
| Molecular Formula | C14H15N7O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[2-[2-(5-amino-2-methylbenzimidazol-1-yl)-2-oxoethyl]triazol-4-yl]acetamide |
| SMILES | CC(=O)Nc1cnn(CC(=O)n2c(C)nc3cc(N)ccc32)n1 |
| InChI | InChI=1S/C14H15N7O2/c1-8-17-11-5-10(15)3-4-12(11)21(8)14(23)7-20-16-6-13(19-20)18-9(2)22/h3-6H,7,15H2,1-2H3,(H,18,19,22) |
| InChIKey | CZLWJTVLEHLUIH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|