C15H16N6O2 — CID 112526809
N-[2-[2-(7-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]acetamide (PubChem CID 112526809) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[2-[2-(7-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]acetamide.
| Compound Name | N-[2-[2-(7-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 112526809 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[2-[2-(7-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]acetamide |
| SMILES | CC(=O)Nc1cnn(CC(=O)n2c(C)cc3cccc(N)c32)n1 |
| InChI | InChI=1S/C15H16N6O2/c1-9-6-11-4-3-5-12(16)15(11)21(9)14(23)8-20-17-7-13(19-20)18-10(2)22/h3-7H,8,16H2,1-2H3,(H,18,19,22) |
| InChIKey | UIGRHGOSIZICNT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|