C14H19N5O3S — CID 112529256
2-[4-(methanesulfonamido)triazol-2-yl]-N-[2-(2-methylphenyl)ethyl]acetamide (PubChem CID 112529256) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is 2-[4-(methanesulfonamido)triazol-2-yl]-N-[2-(2-methylphenyl)ethyl]acetamide.
| Compound Name | 2-[4-(methanesulfonamido)triazol-2-yl]-N-[2-(2-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 112529256 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[4-(methanesulfonamido)triazol-2-yl]-N-[2-(2-methylphenyl)ethyl]acetamide |
| SMILES | Cc1ccccc1CCNC(=O)Cn1ncc(NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C14H19N5O3S/c1-11-5-3-4-6-12(11)7-8-15-14(20)10-19-16-9-13(17-19)18-23(2,21)22/h3-6,9H,7-8,10H2,1-2H3,(H,15,20)(H,17,18) |
| InChIKey | ZQZRPOCDHMIUOX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |