C13H16FN5O3S — CID 112529386
N-[2-(2-fluorophenyl)ethyl]-2-[4-(methanesulfonamido)triazol-1-yl]acetamide (PubChem CID 112529386) has the molecular formula C13H16FN5O3S and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-2-[4-(methanesulfonamido)triazol-1-yl]acetamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-2-[4-(methanesulfonamido)triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 112529386 |
| Molecular Formula | C13H16FN5O3S |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-2-[4-(methanesulfonamido)triazol-1-yl]acetamide |
| SMILES | CS(=O)(=O)Nc1cn(CC(=O)NCCc2ccccc2F)nn1 |
| InChI | InChI=1S/C13H16FN5O3S/c1-23(21,22)17-12-8-19(18-16-12)9-13(20)15-7-6-10-4-2-3-5-11(10)14/h2-5,8,17H,6-7,9H2,1H3,(H,15,20) |
| InChIKey | FQWPSHFHSSRJRA-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |