C16H18N6O3 — CID 112527158
ethyl N-[1-[2-(3-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112527158) has the molecular formula C16H18N6O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is ethyl N-[1-[2-(3-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(3-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112527158 |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | ethyl N-[1-[2-(3-amino-2-methylindol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cn(CC(=O)n2c(C)c(N)c3ccccc32)nn1 |
| InChI | InChI=1S/C16H18N6O3/c1-3-25-16(24)18-13-8-21(20-19-13)9-14(23)22-10(2)15(17)11-6-4-5-7-12(11)22/h4-8H,3,9,17H2,1-2H3,(H,18,24) |
| InChIKey | SNMCDEFMMWSXEZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |