C13H13Cl2N5O3 — CID 112525340
ethyl N-[1-[2-(2,6-dichloroanilino)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112525340) has the molecular formula C13H13Cl2N5O3 and a molecular weight of 358.19 g/mol. Its IUPAC name is ethyl N-[1-[2-(2,6-dichloroanilino)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(2,6-dichloroanilino)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112525340 |
| Molecular Formula | C13H13Cl2N5O3 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | ethyl N-[1-[2-(2,6-dichloroanilino)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cn(CC(=O)Nc2c(Cl)cccc2Cl)nn1 |
| InChI | InChI=1S/C13H13Cl2N5O3/c1-2-23-13(22)16-10-6-20(19-18-10)7-11(21)17-12-8(14)4-3-5-9(12)15/h3-6H,2,7H2,1H3,(H,16,22)(H,17,21) |
| InChIKey | QRGZPOTZJTZNEZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |