C11H13N7O3 — CID 112524316
ethyl N-[1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]triazol-4-yl]carbamate (PubChem CID 112524316) has the molecular formula C11H13N7O3 and a molecular weight of 291.27 g/mol. Its IUPAC name is ethyl N-[1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112524316 |
| Molecular Formula | C11H13N7O3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | ethyl N-[1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cn(CC(=O)Nc2ccncn2)nn1 |
| InChI | InChI=1S/C11H13N7O3/c1-2-21-11(20)15-9-5-18(17-16-9)6-10(19)14-8-3-4-12-7-13-8/h3-5,7H,2,6H2,1H3,(H,15,20)(H,12,13,14,19) |
| InChIKey | AQJSVVCDKROAMZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |