C12H20N6O3 — CID 112530396
ethyl N-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112530396) has the molecular formula C12H20N6O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is ethyl N-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112530396 |
| Molecular Formula | C12H20N6O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | ethyl N-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cn(CC(=O)N2CCN(C)CC2)nn1 |
| InChI | InChI=1S/C12H20N6O3/c1-3-21-12(20)13-10-8-18(15-14-10)9-11(19)17-6-4-16(2)5-7-17/h8H,3-7,9H2,1-2H3,(H,13,20) |
| InChIKey | PYHBQAPNHLBCOD-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |