C10H13N7O3 — CID 112525063
ethyl N-[1-[2-(4-aminopyrazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112525063) has the molecular formula C10H13N7O3 and a molecular weight of 279.26 g/mol. Its IUPAC name is ethyl N-[1-[2-(4-aminopyrazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(4-aminopyrazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112525063 |
| Molecular Formula | C10H13N7O3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | ethyl N-[1-[2-(4-aminopyrazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cn(CC(=O)n2cc(N)cn2)nn1 |
| InChI | InChI=1S/C10H13N7O3/c1-2-20-10(19)13-8-5-16(15-14-8)6-9(18)17-4-7(11)3-12-17/h3-5H,2,6,11H2,1H3,(H,13,19) |
| InChIKey | JEEUFQVSYKJCTP-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |