C9H11N7O3 — CID 112524664
methyl N-[1-[2-(5-aminopyrazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112524664) has the molecular formula C9H11N7O3 and a molecular weight of 265.23 g/mol. Its IUPAC name is methyl N-[1-[2-(5-aminopyrazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | methyl N-[1-[2-(5-aminopyrazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112524664 |
| Molecular Formula | C9H11N7O3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | methyl N-[1-[2-(5-aminopyrazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cn(CC(=O)n2nccc2N)nn1 |
| InChI | InChI=1S/C9H11N7O3/c1-19-9(18)12-7-4-15(14-13-7)5-8(17)16-6(10)2-3-11-16/h2-4H,5,10H2,1H3,(H,12,18) |
| InChIKey | PIVYGANKFDEWHE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |