C14H14N6O3 — CID 112526671
methyl N-[1-[2-(7-aminoindol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112526671) has the molecular formula C14H14N6O3 and a molecular weight of 314.31 g/mol. Its IUPAC name is methyl N-[1-[2-(7-aminoindol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | methyl N-[1-[2-(7-aminoindol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112526671 |
| Molecular Formula | C14H14N6O3 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | methyl N-[1-[2-(7-aminoindol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cn(CC(=O)n2ccc3cccc(N)c32)nn1 |
| InChI | InChI=1S/C14H14N6O3/c1-23-14(22)16-11-7-19(18-17-11)8-12(21)20-6-5-9-3-2-4-10(15)13(9)20/h2-7H,8,15H2,1H3,(H,16,22) |
| InChIKey | HCCCTZMUXUDUGP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|