C14H14N6O3 — CID 112526672
methyl N-[1-[2-(1H-indol-7-ylamino)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112526672) has the molecular formula C14H14N6O3 and a molecular weight of 314.31 g/mol. Its IUPAC name is methyl N-[1-[2-(1H-indol-7-ylamino)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | methyl N-[1-[2-(1H-indol-7-ylamino)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112526672 |
| Molecular Formula | C14H14N6O3 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | methyl N-[1-[2-(1H-indol-7-ylamino)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cn(CC(=O)Nc2cccc3cc[nH]c23)nn1 |
| InChI | InChI=1S/C14H14N6O3/c1-23-14(22)17-11-7-20(19-18-11)8-12(21)16-10-4-2-3-9-5-6-15-13(9)10/h2-7,15H,8H2,1H3,(H,16,21)(H,17,22) |
| InChIKey | SQWWOTYUHPCITN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |