C15H16N6O2 — CID 112526094
N-[1-[2-(1H-indol-5-ylamino)-2-oxoethyl]triazol-4-yl]propanamide (PubChem CID 112526094) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[1-[2-(1H-indol-5-ylamino)-2-oxoethyl]triazol-4-yl]propanamide.
| Compound Name | N-[1-[2-(1H-indol-5-ylamino)-2-oxoethyl]triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 112526094 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[1-[2-(1H-indol-5-ylamino)-2-oxoethyl]triazol-4-yl]propanamide |
| SMILES | CCC(=O)Nc1cn(CC(=O)Nc2ccc3[nH]ccc3c2)nn1 |
| InChI | InChI=1S/C15H16N6O2/c1-2-14(22)18-13-8-21(20-19-13)9-15(23)17-11-3-4-12-10(7-11)5-6-16-12/h3-8,16H,2,9H2,1H3,(H,17,23)(H,18,22) |
| InChIKey | HAIJBQJYSWXHOA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |