C14H15N7O3 — CID 112523159
ethyl N-[1-[2-(1H-benzimidazol-4-ylamino)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112523159) has the molecular formula C14H15N7O3 and a molecular weight of 329.32 g/mol. Its IUPAC name is ethyl N-[1-[2-(1H-benzimidazol-4-ylamino)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(1H-benzimidazol-4-ylamino)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112523159 |
| Molecular Formula | C14H15N7O3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | ethyl N-[1-[2-(1H-benzimidazol-4-ylamino)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cn(CC(=O)Nc2cccc3[nH]cnc23)nn1 |
| InChI | InChI=1S/C14H15N7O3/c1-2-24-14(23)18-11-6-21(20-19-11)7-12(22)17-10-5-3-4-9-13(10)16-8-15-9/h3-6,8H,2,7H2,1H3,(H,15,16)(H,17,22)(H,18,23) |
| InChIKey | JURPXSOGEYFRSO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |